Benzyl-PEG2-Tos
Modify Date: 2025-09-09 23:11:35
Benzyl-PEG2-Tos structure
|
Common Name | Benzyl-PEG2-Tos | ||
|---|---|---|---|---|
| CAS Number | 98627-22-6 | Molecular Weight | 350.429 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 487.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C18H22O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.6±25.9 °C | |
Use of Benzyl-PEG2-TosBenzyl-PEG2-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-[2-(Benzyloxy)ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Benzyl-PEG2-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.4±35.0 °C at 760 mmHg |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.429 |
| Flash Point | 248.6±25.9 °C |
| Exact Mass | 350.118805 |
| LogP | 3.00 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | NFEMXFVBUWGQRW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCc2ccccc2)cc1 |
| 2-[2-(Benzyloxy)ethoxy]ethyl 4-methylbenzenesulfonate |
| Ethanol, 2-[2-(phenylmethoxy)ethoxy]-, 4-methylbenzenesulfonate |
| MFCD28064331 |