(2,4-difluorophenyl)-(2,4-difluorophenyl)imino-oxidoazanium structure
|
Common Name | (2,4-difluorophenyl)-(2,4-difluorophenyl)imino-oxidoazanium | ||
|---|---|---|---|---|
| CAS Number | 98583-27-8 | Molecular Weight | 270.18200 | |
| Density | 1.39g/cm3 | Boiling Point | 337.4ºC at 760 mmHg | |
| Molecular Formula | C12H6F4N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.8ºC | |
| Name | (2,4-difluorophenyl)-(2,4-difluorophenyl)imino-oxidoazanium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 337.4ºC at 760 mmHg |
| Molecular Formula | C12H6F4N2O |
| Molecular Weight | 270.18200 |
| Flash Point | 157.8ºC |
| Exact Mass | 270.04200 |
| PSA | 41.11000 |
| LogP | 4.69190 |
| Index of Refraction | 1.534 |
| InChIKey | SVPAOXCKVYBZDA-UHFFFAOYSA-N |
| SMILES | [O-][N+](=Nc1ccc(F)cc1F)c1ccc(F)cc1F |
|
~87%
(2,4-difluoroph... CAS#:98583-27-8 |
| Literature: Korobeinicheva, I. K.; Fugaeva, O. M.; Furin, G. G. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1986 , vol. 35, p. 1391 - 1397 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1986 , # 7 p. 1537 - 1544 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (2,4-difluorophenyl)-(2,4-difluorophenyl)imino-oxido-azanium |
| 2,2',4,4'-tetrafluoroazoxybenzene |
| Diazene,bis(2,4-difluorophenyl)-1-oxide |
| 1-[(Z)-(2,4-difluorophenyl)-NNO-azoxy]-2,4-difluorobenzene |