3-bromo-4-hydroxy-5-nitrobenzaldehyde
Modify Date: 2025-09-11 20:13:35
3-bromo-4-hydroxy-5-nitrobenzaldehyde structure
|
Common Name | 3-bromo-4-hydroxy-5-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 98555-49-8 | Molecular Weight | 246.01500 | |
| Density | 1.928g/cm3 | Boiling Point | 278.1ºC at 760 mmHg | |
| Molecular Formula | C7H4BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122ºC | |
| Name | 3-bromo-4-hydroxy-5-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.928g/cm3 |
|---|---|
| Boiling Point | 278.1ºC at 760 mmHg |
| Molecular Formula | C7H4BrNO4 |
| Molecular Weight | 246.01500 |
| Flash Point | 122ºC |
| Exact Mass | 244.93200 |
| PSA | 83.12000 |
| LogP | 2.39860 |
| Index of Refraction | 1.696 |
| InChIKey | QBGJRIICMHIJJR-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(Br)c(O)c([N+](=O)[O-])c1 |
| HS Code | 2913000090 |
|---|
|
~%
3-bromo-4-hydro... CAS#:98555-49-8 |
| Literature: N.V. ORGANON Patent: WO2006/117370 A1, 2006 ; Location in patent: Page/Page column 35; 39; 51 ; WO 2006/117370 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 5-bromo-4-hydroxy-3-nitrobenzaldehyde |
| 5-Brom-3-nitro-4-hydroxybenzaldehyd |
| 3-bromo-4-hydroxy-5-nitro-benzaldehyde |