1,3-Butanedione, 1-(6-methoxy-2-naphthalenyl)
Modify Date: 2025-08-25 17:33:53
1,3-Butanedione, 1-(6-methoxy-2-naphthalenyl) structure
|
Common Name | 1,3-Butanedione, 1-(6-methoxy-2-naphthalenyl) | ||
|---|---|---|---|---|
| CAS Number | 98386-82-4 | Molecular Weight | 242.27000 | |
| Density | 1.157g/cm3 | Boiling Point | 405.9ºC at 760mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.3ºC | |
| Name | 1,3-Butanedione, 1-(6-methoxy-2-naphthalenyl) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 405.9ºC at 760mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 181.3ºC |
| Exact Mass | 242.09400 |
| PSA | 43.37000 |
| LogP | 3.01020 |
| Index of Refraction | 1.584 |
| InChIKey | HGXDFGVHMYOSDC-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc(C(=O)CC(C)=O)ccc2c1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(6-methoxy-2-benzothiazolyl)-3-phenylurea |
| Frentizol |
| 1-(6-methoxy-benzothiazol-2-yl)-3-phenyl-urea |
| FRENTIZOLE |
| 1-(6-methoxybenzo[d]thiazol-2-yl)-3-phenylurea |
| 4-(6'-methoxy-2'-naphthyl)butan-2,4-dione |
| 1-(6-methoxy-2-naphthalenyl)-1,3-butanedione |
| 1-(6-methoxynaphthalen-2-yl)butane-1,3-dione |