1,10-phenanthroline,quinoxalino[2,3-f][1,9]phenanthroline,ruthenium(2+)
Modify Date: 2025-11-25 17:15:25
![1,10-phenanthroline,quinoxalino[2,3-f][1,9]phenanthroline,ruthenium(2+) Structure](https://image.chemsrc.com/caspic/142/98300-80-2.png)
1,10-phenanthroline,quinoxalino[2,3-f][1,9]phenanthroline,ruthenium(2+) structure
|
Common Name | 1,10-phenanthroline,quinoxalino[2,3-f][1,9]phenanthroline,ruthenium(2+) | ||
|---|---|---|---|---|
| CAS Number | 98300-80-2 | Molecular Weight | 743.77900 | |
| Density | 2.09g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C42H26N8Ru++ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,10-phenanthroline,quinoxalino[2,3-f][1,9]phenanthroline,ruthenium(2+) |
|---|---|
| Synonym | More Synonyms |
| Density | 2.09g/cm3 |
|---|---|
| Molecular Formula | C42H26N8Ru++ |
| Molecular Weight | 743.77900 |
| Exact Mass | 744.13200 |
| PSA | 103.12000 |
| LogP | 9.44540 |
| Index of Refraction | 1.751 |
| InChIKey | HOEWKBQADMRCLO-UHFFFAOYSA-N |
| SMILES | Nc1ccn(C2OC(COP(=O)(O)OC3(C(=O)O)CC(O)C(NC(=O)CO)C(C(O)C(O)CO)O3)C(O)C2O)c(=O)n1 |
| Bis(1,10-phenanthroline)(dipyrido(3,2-a:2',3'-c)phenazine)ruthenium (II) |
| Bpdp-Ru |
| 1,10-phenanthroline,compd. with dipyrido[3,2-a:3',4'-c]phenazine,ruthenium(2+) salt(2:1:1) |
| quinoxalino[2,3-f][1,9]phenanthroline |