2,3-diamino-5-nitrobenzoic acid
Modify Date: 2025-08-25 13:47:44
2,3-diamino-5-nitrobenzoic acid structure
|
Common Name | 2,3-diamino-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 98279-87-9 | Molecular Weight | 197.14800 | |
| Density | 1.665 g/cm3 | Boiling Point | 521.3ºC at 760 mmHg | |
| Molecular Formula | C7H7N3O4 | Melting Point | >245ºC | |
| MSDS | N/A | Flash Point | 269ºC | |
| Name | 2,3-diamino-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.665 g/cm3 |
|---|---|
| Boiling Point | 521.3ºC at 760 mmHg |
| Melting Point | >245ºC |
| Molecular Formula | C7H7N3O4 |
| Molecular Weight | 197.14800 |
| Flash Point | 269ºC |
| Exact Mass | 197.04400 |
| PSA | 135.16000 |
| LogP | 2.14300 |
| InChIKey | VYSNGNBMJHEJBV-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])cc(C(=O)O)c1N |
| HS Code | 2922499990 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 5-Nitro-2.3-diamino-benzoesaeure |
| Benzoic acid,2,3-diamino-5-nitro |