tris(trimethylsilyl)methanethiol
Modify Date: 2025-11-26 11:34:31
tris(trimethylsilyl)methanethiol structure
|
Common Name | tris(trimethylsilyl)methanethiol | ||
|---|---|---|---|---|
| CAS Number | 98195-03-0 | Molecular Weight | 264.65100 | |
| Density | 0.84g/cm3 | Boiling Point | 234.7ºC at 760mmHg | |
| Molecular Formula | C10H28SSi3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.7ºC | |
| Name | tris(trimethylsilyl)methanethiol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.84g/cm3 |
|---|---|
| Boiling Point | 234.7ºC at 760mmHg |
| Molecular Formula | C10H28SSi3 |
| Molecular Weight | 264.65100 |
| Flash Point | 95.7ºC |
| Exact Mass | 264.12200 |
| PSA | 38.80000 |
| LogP | 4.70710 |
| Index of Refraction | 1.436 |
| InChIKey | IBVDLFLORATGQR-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(S)([Si](C)(C)C)[Si](C)(C)C |
|
~%
tris(trimethyls... CAS#:98195-03-0 |
| Literature: Block,E.; Aslam,M. Journal of the American Chemical Society, 1985 , vol. 107, p. 6729 |
|
~%
tris(trimethyls... CAS#:98195-03-0 |
| Literature: Ricci, Alfredo; Degl'Innocenti, Alessandro; Fiorenza, Mariella; Dembech, Pasqualle; Ramadam, Nazmi; et al. Tetrahedron Letters, 1985 , vol. 26, # 8 p. 1091 - 1092 |
|
~%
tris(trimethyls... CAS#:98195-03-0 |
| Literature: Block, Eric; Aslam, Mohammad Tetrahedron Letters, 1985 , vol. 26, # 19 p. 2259 - 2262 |
![trimethyl-[methylsulfanyl-bis(trimethylsilyl)methyl]silane structure](https://image.chemsrc.com/caspic/199/31704-09-3.png)
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:99405-17-1| Methanethiol,tris(trimethylsilyl) |
| tris(trimethylsilyl)metanethiol |
| Tris(trimethylsilyl)methylsulfane |