3-[7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-8-propyl-3,4-dihydro-2H-chromen-2-yl]propanoic acid
Modify Date: 2025-09-13 18:53:49
![3-[7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-8-propyl-3,4-dihydro-2H-chromen-2-yl]propanoic acid Structure](https://image.chemsrc.com/caspic/163/98193-29-4.png)
3-[7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-8-propyl-3,4-dihydro-2H-chromen-2-yl]propanoic acid structure
|
Common Name | 3-[7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-8-propyl-3,4-dihydro-2H-chromen-2-yl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 98193-29-4 | Molecular Weight | 498.60800 | |
| Density | 1.159g/cm3 | Boiling Point | 679.9ºC at 760mmHg | |
| Molecular Formula | C29H38O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.7ºC | |
| Name | 3-[7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-8-propyl-3,4-dihydro-2H-chromen-2-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 679.9ºC at 760mmHg |
| Molecular Formula | C29H38O7 |
| Molecular Weight | 498.60800 |
| Flash Point | 219.7ºC |
| Exact Mass | 498.26200 |
| PSA | 102.29000 |
| LogP | 5.90610 |
| Index of Refraction | 1.555 |
| InChIKey | UHAYGLCGMYKNGL-UHFFFAOYSA-N |
| SMILES | CCCc1c(OCCCOc2ccc3c(c2CCC)OC(CCC(=O)O)CC3)ccc(C(C)=O)c1O |
|
~%
3-[7-[3-(4-acet... CAS#:98193-29-4 |
| Literature: G. D. Searle and Co. Patent: US4665203 A1, 1987 ; |
| 3-[6-(tetrahydropyranyloxy)hexyl]thiophene |
| 7-<3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy>-3,4-dihydro-8-propyl-2H-1-benzopyran-2-propionic acid |
| 3-[7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-3,4-dihydro-8-propyl-2H-1-benzopyran-2-yl]propanoic acid |
| 2H-Pyran,tetrahydro-2-[[6-(3-thienyl)hexyl]oxy] |
| 3-(6-(2-tetrahydropyranyloxy)hexyl)thiophene |
| 2-[4-(3-thienyl)-hexyloxy]tetrahydropyrane |