6,8-dichloro-2-methylsulfanyl-7H-purine structure
|
Common Name | 6,8-dichloro-2-methylsulfanyl-7H-purine | ||
|---|---|---|---|---|
| CAS Number | 98141-45-8 | Molecular Weight | 235.09400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4Cl2N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,8-dichloro-2-methylsulfanyl-7H-purine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H4Cl2N4S |
|---|---|
| Molecular Weight | 235.09400 |
| Exact Mass | 233.95300 |
| PSA | 79.76000 |
| LogP | 2.38160 |
| InChIKey | HCDIZFGKFJHVDP-UHFFFAOYSA-N |
| SMILES | CSc1nc(Cl)c2[nH]c(Cl)nc2n1 |
|
~%
6,8-dichloro-2-... CAS#:98141-45-8 |
| Literature: Noell; Robins Journal of Organic Chemistry, 1959 , vol. 24, p. 320,321 |
|
~%
6,8-dichloro-2-... CAS#:98141-45-8 |
| Literature: Noell; Robins Journal of Organic Chemistry, 1959 , vol. 24, p. 320,321 |
| 6,8-Dichlor-2-methylmercapto-7(9)H-purin |
| 6,8-dichloro-2-methylsulfanyl-7(9)H-purine |
| 1H-Purine,6,8-dichloro-2-(methylthio) |