Sulukast structure
|
Common Name | Sulukast | ||
|---|---|---|---|---|
| CAS Number | 98116-53-1 | Molecular Weight | 472.64300 | |
| Density | 1.169g/cm3 | Boiling Point | 703.9ºC at 760 mmHg | |
| Molecular Formula | C25H36N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 379.5ºC | |
Use of SulukastSulukast is an antagonist of the cysteinyl leukotrienes C4, D4, and E4. |
| Name | 3-[(1S,2R,3E,5Z)-1-hydroxy-1-[3-(2H-tetrazol-5-yl)phenyl]pentadeca-3,5-dien-2-yl]sulfanylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 703.9ºC at 760 mmHg |
| Molecular Formula | C25H36N4O3S |
| Molecular Weight | 472.64300 |
| Flash Point | 379.5ºC |
| Exact Mass | 472.25100 |
| PSA | 137.29000 |
| LogP | 5.72970 |
| Index of Refraction | 1.579 |
| InChIKey | YPHOSUPSOWQQCB-AFOLHBCXSA-N |
| SMILES | CCCCCCCCCC=CC=CC(SCCC(=O)O)C(O)c1cccc(-c2nn[nH]n2)c1 |
| Sulukastum |
| Sulukast (USAN/INN) |
| UNII-M652A5186T |
| Sulukastum [INN-Latin] |
| Sulukast |