N-[4-(4-nitrosophenyl)phenyl]acetamide structure
|
Common Name | N-[4-(4-nitrosophenyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 98095-75-1 | Molecular Weight | 240.25700 | |
| Density | 1.17g/cm3 | Boiling Point | 475.4ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.3ºC | |
| Name | N-[4-(4-nitrosophenyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 475.4ºC at 760 mmHg |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.25700 |
| Flash Point | 241.3ºC |
| Exact Mass | 240.09000 |
| PSA | 62.02000 |
| LogP | 4.35940 |
| Index of Refraction | 1.597 |
| InChIKey | CRWBUYGTIDWBPD-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(-c2ccc(N=O)cc2)cc1 |
|
~%
N-[4-(4-nitroso... CAS#:98095-75-1 |
| Literature: Cain Journal of the Chemical Society, 1909 , vol. 95, p. 717 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-(4'-nitroso-biphenyl-4-yl)-acetamide |
| 4'-Nitroso-4-acetamino-diphenyl |