cyclopentene,2-methylbuta-1,3-diene,styrene structure
|
Common Name | cyclopentene,2-methylbuta-1,3-diene,styrene | ||
|---|---|---|---|---|
| CAS Number | 98085-64-4 | Molecular Weight | 240.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cyclopentene,2-methylbuta-1,3-diene,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H24 |
|---|---|
| Molecular Weight | 240.38300 |
| Exact Mass | 240.18800 |
| LogP | 5.80460 |
| InChIKey | YDSLFQRJPBAQFA-UHFFFAOYSA-N |
| SMILES | C1=CCCC1.C=CC(=C)C.C=Cc1ccccc1 |
| Benzene,ethenyl-,polymer with cyclopentene and 2-methyl-1,3-butadiene |