5-Chloro-2-methyl-4-nitropyridine 1-oxide structure
|
Common Name | 5-Chloro-2-methyl-4-nitropyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 97944-39-3 | Molecular Weight | 188.56800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-Chloro-2-methyl-4-nitropyridine 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H5ClN2O3 |
|---|---|
| Molecular Weight | 188.56800 |
| Exact Mass | 187.99900 |
| PSA | 71.28000 |
| LogP | 2.50830 |
| InChIKey | WMNCRPKSHGXZFI-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)c[n+]1[O-] |
|
~%
5-Chloro-2-meth... CAS#:97944-39-3 |
| Literature: Ife; Dyke; Keeling; Meenan; Meeson; Parsons; Price; Theobald; Underwood Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1970 - 1977 |
|
~%
5-Chloro-2-meth... CAS#:97944-39-3 |
| Literature: Ife; Dyke; Keeling; Meenan; Meeson; Parsons; Price; Theobald; Underwood Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1970 - 1977 |
| 5-chloro-4-methyl-2-thiophenecarboxylic acid ethyl ester |
| 5-chloro-4-nitro-2-methylpyridine-N-oxide |