4-oxo-4-phenylbutane-1,1,2,2-tetracarbonitrile structure
|
Common Name | 4-oxo-4-phenylbutane-1,1,2,2-tetracarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 97841-62-8 | Molecular Weight | 248.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-oxo-4-phenylbutane-1,1,2,2-tetracarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H8N4O |
|---|---|
| Molecular Weight | 248.24000 |
| Exact Mass | 248.07000 |
| PSA | 112.23000 |
| LogP | 1.95632 |
| InChIKey | YZQSMRDMXPDHAX-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)C(C#N)(C#N)CC(=O)c1ccccc1 |
|
~%
4-oxo-4-phenylb... CAS#:97841-62-8 |
| Literature: Middleton; Engelhardt Journal of the American Chemical Society, 1958 , vol. 80, p. 2788,2793 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Oxo-4-phenyl-butan-1,1,2,2-tetracarbonitril |
| 4-oxo-4-phenyl-butane-1,1,2,2-tetracarbonitrile |
| 1-Phenyl-3,3,4,4-tetracyan-butanon-(1) |
| 1,1,2,2-Butanetetracarbonitrile,4-oxo-4-phenyl |