4-(4-fluorophenyl)-1-phenyl-3,5,8-trioxabicyclo[2.2.2]octane structure
|
Common Name | 4-(4-fluorophenyl)-1-phenyl-3,5,8-trioxabicyclo[2.2.2]octane | ||
|---|---|---|---|---|
| CAS Number | 97720-28-0 | Molecular Weight | 286.29800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-fluorophenyl)-1-phenyl-3,5,8-trioxabicyclo[2.2.2]octane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15FO3 |
|---|---|
| Molecular Weight | 286.29800 |
| Exact Mass | 286.10100 |
| PSA | 27.69000 |
| LogP | 2.95100 |
| InChIKey | LHVWTCGOLAOAND-UHFFFAOYSA-N |
| SMILES | Fc1ccc(C23OCC(c4ccccc4)(CO2)CO3)cc1 |
| p-Fluoroorthobenzoic acid cyclic ester with 2-(hydroxymethyl)-2-phenyl-1,3-propanediol |
| 2,6,7-Trioxabicyclo(2.2.2)octane,1-(4-fluorophenyl)-4-phenyl |
| Orthobenzoic acid,p-fluoro-,cyclic ester with 2-(hydroxymethyl)-2-phenyl-1,3-propanediol |
| 1-(4-Fluorophenyl)-4-phenylorthobicycloorthocarboxylate |