1-butyl-4-(4-chlorophenyl)-3,5,8-trioxabicyclo[2.2.2]octane
Modify Date: 2025-08-25 16:29:46
![1-butyl-4-(4-chlorophenyl)-3,5,8-trioxabicyclo[2.2.2]octane Structure](https://image.chemsrc.com/caspic/143/97719-91-0.png)
1-butyl-4-(4-chlorophenyl)-3,5,8-trioxabicyclo[2.2.2]octane structure
|
Common Name | 1-butyl-4-(4-chlorophenyl)-3,5,8-trioxabicyclo[2.2.2]octane | ||
|---|---|---|---|---|
| CAS Number | 97719-91-0 | Molecular Weight | 282.76300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-butyl-4-(4-chlorophenyl)-3,5,8-trioxabicyclo[2.2.2]octane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H19ClO3 |
|---|---|
| Molecular Weight | 282.76300 |
| Exact Mass | 282.10200 |
| PSA | 27.69000 |
| LogP | 3.70390 |
| InChIKey | FVPOTPXWFCCIHG-UHFFFAOYSA-N |
| SMILES | CCCCC12COC(c3ccc(Cl)cc3)(OC1)OC2 |
| Orthobenzoic acid,p-chloro-,cyclic ester with 2-butyl-2-(hydroxymethyl)-1,3-propanediol |
| p-Chloroorthobenzoic acid cyclic ester with 2-butyl-2-(hydroxymethyl)-1,3-propanediol |
| 4-Butyl-1-(4-chlorophenyl)bicycloorthocarboxylate |
| 4-butyl-1-(4-chlorophenyl)-2,6,7-trioxabicyclo[2.2.2]octane |
| 2,6,7-Trioxabicyclo(2.2.2)octane,4-butyl-1-(4-chlorophenyl) |