N-(2,4-dichloro-6-nitrophenyl)benzamide structure
|
Common Name | N-(2,4-dichloro-6-nitrophenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 97661-75-1 | Molecular Weight | 311.12000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,4-dichloro-6-nitrophenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8Cl2N2O3 |
|---|---|
| Molecular Weight | 311.12000 |
| Exact Mass | 309.99100 |
| PSA | 78.41000 |
| LogP | 5.06110 |
| InChIKey | VZRJZZKNMCDYBU-UHFFFAOYSA-N |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1[N+](=O)[O-])c1ccccc1 |
|
~82%
N-(2,4-dichloro... CAS#:97661-75-1 |
| Literature: Iley, Jim; Carvalho, Emilia; Norberto, Fatima; Rosa, Eduarda Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1992 , # 2 p. 281 - 290 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzamide,N-(2,4-dichloro-6-nitrophenyl) |