2-cyano-3-(4-methylphenyl)prop-2-enethioamide structure
|
Common Name | 2-cyano-3-(4-methylphenyl)prop-2-enethioamide | ||
|---|---|---|---|---|
| CAS Number | 97651-32-6 | Molecular Weight | 202.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-cyano-3-(4-methylphenyl)prop-2-enethioamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10N2S |
|---|---|
| Molecular Weight | 202.27500 |
| Exact Mass | 202.05600 |
| PSA | 86.44000 |
| LogP | 2.90878 |
| InChIKey | UVYUOMXJJABTKR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C=C(C#N)C(N)=S)cc1 |
|
~%
2-cyano-3-(4-me... CAS#:97651-32-6 |
| Literature: Brunskill,J.S.A. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1978 , p. 629 - 633 |
| 2-Propenethioamide,2-cyano-3-(4-methylphenyl) |
| p-tolylmethylenecyanothioacetamide |