1-(4-methylphenyl)-3-pyrrolidin-1-ylpropan-1-one,hydrochloride structure
|
Common Name | 1-(4-methylphenyl)-3-pyrrolidin-1-ylpropan-1-one,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 97635-24-0 | Molecular Weight | 253.76800 | |
| Density | N/A | Boiling Point | 349.3ºC at 760 mmHg | |
| Molecular Formula | C14H20ClNO | Melting Point | 152-157ºC(lit.) | |
| MSDS | USA | Flash Point | 129.5ºC | |
| Name | 1-(4-methylphenyl)-3-pyrrolidin-1-ylpropan-1-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 349.3ºC at 760 mmHg |
|---|---|
| Melting Point | 152-157ºC(lit.) |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.76800 |
| Flash Point | 129.5ºC |
| Exact Mass | 253.12300 |
| PSA | 20.31000 |
| LogP | 3.40350 |
| InChIKey | LZTSEHXSSHJUIV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CCN2CCCC2)cc1.Cl |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~%
1-(4-methylphen... CAS#:97635-24-0 |
| Literature: Huang; Hall Pharmazie, 1996 , vol. 51, # 4 p. 199 - 206 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Pyrrolidino-1-p-tolyl-propan-1-on,Hydrochlorid |
| 1-(4-Methylphenyl)-3-(1-pyrrolidinyl)propan-1-one hydrochloride |
| 1-(4-methylphenyl)-3-pyrrolidin-1-ylpropan-1-one hydrochloride |
| EINECS 307-385-7 |
| 3-pyrrolidino-1-p-tolyl-propan-1-one,hydrochloride |
| 1-(4-Methylphenyl)-3-(1-pyrrolidinyl)-1-propanone hydrochloride |