3-butyl-1-ethyl-2-oxopurine-6-thiolate,2-hydroxyethyl(trimethyl)azanium
Modify Date: 2025-08-30 11:27:45
3-butyl-1-ethyl-2-oxopurine-6-thiolate,2-hydroxyethyl(trimethyl)azanium structure
|
Common Name | 3-butyl-1-ethyl-2-oxopurine-6-thiolate,2-hydroxyethyl(trimethyl)azanium | ||
|---|---|---|---|---|
| CAS Number | 97616-67-6 | Molecular Weight | 355.49900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H29N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-butyl-1-ethyl-2-oxopurine-6-thiolate,2-hydroxyethyl(trimethyl)azanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H29N5O2S |
|---|---|
| Molecular Weight | 355.49900 |
| Exact Mass | 355.20400 |
| PSA | 72.94000 |
| LogP | 1.00370 |
| InChIKey | AUWLVSSAEDVSBD-UHFFFAOYSA-M |
| SMILES | CCCCn1c2ncnc-2c([S-])n(CC)c1=O.C[N+](C)(C)CCO |
| B 5904 |
| Xanthine,3-butyl-1-ethyl-6-thio-,compd. with choline (1:1) |
| M B 5904 |
| Choline,compd. with 3-butyl-1-ethyl-6-thioxanthine |