S-Phenylsulfonylcysteine
Modify Date: 2025-10-20 21:43:50
S-Phenylsulfonylcysteine structure
|
Common Name | S-Phenylsulfonylcysteine | ||
|---|---|---|---|---|
| CAS Number | 97512-83-9 | Molecular Weight | 261.318 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 475.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C9H11NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.2±31.5 °C | |
Use of S-PhenylsulfonylcysteineS-Nitrosylation reactions regulate protein function and mediate nitrosative stress. |
| Name | S-Phenylsulfonylcysteine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 475.2±55.0 °C at 760 mmHg |
| Molecular Formula | C9H11NO4S2 |
| Molecular Weight | 261.318 |
| Flash Point | 241.2±31.5 °C |
| Exact Mass | 261.012939 |
| LogP | 1.16 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | YKYWKTOUPAICGF-QMMMGPOBSA-N |
| SMILES | NC(CSS(=O)(=O)c1ccccc1)C(=O)O |
| S-Phenylsulfonylcysteine |
| 3-[(Phenylsulfonyl)sulfanyl]-L-alanine |
| S-(phenylsulfonyl)-L-cysteine |
| L-Alanine, 3-[(phenylsulfonyl)thio]- |