2-[[2-(5-bromo-1H-indol-3-yl)-2-oxoacetyl]amino]propanoic acid
Modify Date: 2025-08-26 13:36:46
![2-[[2-(5-bromo-1H-indol-3-yl)-2-oxoacetyl]amino]propanoic acid Structure](https://image.chemsrc.com/caspic/038/97500-74-8.png)
2-[[2-(5-bromo-1H-indol-3-yl)-2-oxoacetyl]amino]propanoic acid structure
|
Common Name | 2-[[2-(5-bromo-1H-indol-3-yl)-2-oxoacetyl]amino]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 97500-74-8 | Molecular Weight | 339.14100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[2-(5-bromo-1H-indol-3-yl)-2-oxoacetyl]amino]propanoic acid |
|---|
| Molecular Formula | C13H11BrN2O4 |
|---|---|
| Molecular Weight | 339.14100 |
| Exact Mass | 337.99000 |
| PSA | 99.26000 |
| LogP | 2.09330 |
| InChIKey | FHBNSFJTPVQADH-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)C(=O)c1c[nH]c2ccc(Br)cc12)C(=O)O |
|
~86%
2-[[2-(5-bromo-... CAS#:97500-74-8 |
| Literature: Da Settimo; Primofiore; Marini; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 6 p. 507 - 511 |
|
~%
2-[[2-(5-bromo-... CAS#:97500-74-8 |
| Literature: Da Settimo; Primofiore; Marini; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 6 p. 507 - 511 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |