4-[1-(4-chlorophenyl)-4-methylpentoxy]-4-oxobutanoic acid structure
|
Common Name | 4-[1-(4-chlorophenyl)-4-methylpentoxy]-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 97492-93-8 | Molecular Weight | 312.78900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[1-(4-chlorophenyl)-4-methylpentoxy]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H21ClO4 |
|---|---|
| Molecular Weight | 312.78900 |
| Exact Mass | 312.11300 |
| PSA | 63.60000 |
| LogP | 4.22530 |
| InChIKey | IJVMXOZKWHUACE-UHFFFAOYSA-N |
| SMILES | CC(C)CCC(OC(=O)CCC(=O)O)c1ccc(Cl)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
4-[1-(4-chlorop... CAS#:97492-93-8 |
| Literature: Palazzo,G. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1961 , vol. 4, # 3 p. 447 - 456 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| AF 561 |
| Bernsteinsaeure-mono-[4-methyl-1-(4-chlor-phenyl)-pentylester] |