9-hydroxy-7-(2-hydroxyphenyl)-[1,3]dioxolo[4,5-g]chromen-8-one
Modify Date: 2025-08-25 10:46:12
![9-hydroxy-7-(2-hydroxyphenyl)-[1,3]dioxolo[4,5-g]chromen-8-one Structure](https://image.chemsrc.com/caspic/091/97359-75-6.png)
9-hydroxy-7-(2-hydroxyphenyl)-[1,3]dioxolo[4,5-g]chromen-8-one structure
|
Common Name | 9-hydroxy-7-(2-hydroxyphenyl)-[1,3]dioxolo[4,5-g]chromen-8-one | ||
|---|---|---|---|---|
| CAS Number | 97359-75-6 | Molecular Weight | 298.24700 | |
| Density | 1.592g/cm3 | Boiling Point | 541.4ºC at 760mmHg | |
| Molecular Formula | C16H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.9ºC | |
| Name | 9-hydroxy-7-(2-hydroxyphenyl)-[1,3]dioxolo[4,5-g]chromen-8-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.592g/cm3 |
|---|---|
| Boiling Point | 541.4ºC at 760mmHg |
| Molecular Formula | C16H10O6 |
| Molecular Weight | 298.24700 |
| Flash Point | 208.9ºC |
| Exact Mass | 298.04800 |
| PSA | 89.13000 |
| LogP | 2.59990 |
| Index of Refraction | 1.721 |
| InChIKey | ITRQVDOUFMSYII-UHFFFAOYSA-N |
| SMILES | O=c1c(-c2ccccc2O)coc2cc3c(c(O)c12)OCO3 |
| HS Code | 2932999099 |
|---|
|
~%
9-hydroxy-7-(2-... CAS#:97359-75-6 |
| Literature: Takahashi, Hajime; Sasaki, Teruji; Ito, Masaaki Bulletin of the Chemical Society of Japan, 1987 , vol. 60, # 6 p. 2261 - 2262 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,2'-dihydroxy-6,7-methylenedioxyisoflavone |
| 8H-1,3-Dioxolo(4,5-g)(1)benzopyran-8-one,9-hydroxy-7-(2-hydroxyphenyl) |
| Irisone B |
| 5,2'-Dihydroxy-6,7-methylendioxy-isoflavon |
| 2',5-Dihydroxy-6,7-methylenedioxyisoflavone |
| 9-hydroxy-7-(2-hydroxy-phenyl)-[1,3]dioxolo[4,5-g]chromen-8-one |