(3R,4R)-4-amino-3-((1-carboxyvinyl)oxy)cyclohexa-1,5-dienecarboxylic acid
Modify Date: 2025-08-25 08:07:48
(3R,4R)-4-amino-3-((1-carboxyvinyl)oxy)cyclohexa-1,5-dienecarboxylic acid structure
|
Common Name | (3R,4R)-4-amino-3-((1-carboxyvinyl)oxy)cyclohexa-1,5-dienecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 97279-79-3 | Molecular Weight | 225.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3R,4R)-4-amino-3-((1-carboxyvinyl)oxy)cyclohexa-1,5-dienecarboxylic acid |
|---|
| Molecular Formula | C10H11NO5 |
|---|---|
| Molecular Weight | 225.19800 |
| Exact Mass | 225.06400 |
| PSA | 109.85000 |
| LogP | 0.57830 |
| InChIKey | OIUJHGOLFKDBSU-BRFYHDHCSA-M |
| SMILES | C=C(OC1C=C(C(=O)O)C=CC1N)C(=O)[O-] |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |