N-(7-bromo-1-methylsulfanyl-9H-fluoren-2-yl)acetamide
Modify Date: 2025-08-25 18:06:30
N-(7-bromo-1-methylsulfanyl-9H-fluoren-2-yl)acetamide structure
|
Common Name | N-(7-bromo-1-methylsulfanyl-9H-fluoren-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 97235-37-5 | Molecular Weight | 348.25700 | |
| Density | 1.53g/cm3 | Boiling Point | 524.7ºC at 760 mmHg | |
| Molecular Formula | C16H14BrNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.1ºC | |
| Name | N-(7-bromo-1-methylsulfanyl-9H-fluoren-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 524.7ºC at 760 mmHg |
| Molecular Formula | C16H14BrNOS |
| Molecular Weight | 348.25700 |
| Flash Point | 271.1ºC |
| Exact Mass | 346.99800 |
| PSA | 57.89000 |
| LogP | 5.35010 |
| Index of Refraction | 1.697 |
| InChIKey | JYGWTANDYGNUOL-UHFFFAOYSA-N |
| SMILES | CSc1c(NC(C)=O)ccc2c1Cc1cc(Br)ccc1-2 |
|
~%
N-(7-bromo-1-me... CAS#:97235-37-5 |
| Literature: Elfarra; Hanna Journal of Medicinal Chemistry, 1985 , vol. 28, # 10 p. 1453 - 1460 |
|
~%
N-(7-bromo-1-me... CAS#:97235-37-5 |
| Literature: Elfarra; Hanna Journal of Medicinal Chemistry, 1985 , vol. 28, # 10 p. 1453 - 1460 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Acetamide,N-(7-bromo-1-(methylthio)-9h-fluoren-2-yl) |
| 1-(methylthio)-7-bromo-2-acetamidofluorene |