N-(7-fluoro-1-methylsulfanyl-9H-fluoren-2-yl)acetamide
Modify Date: 2025-08-25 15:43:11
N-(7-fluoro-1-methylsulfanyl-9H-fluoren-2-yl)acetamide structure
|
Common Name | N-(7-fluoro-1-methylsulfanyl-9H-fluoren-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 97235-36-4 | Molecular Weight | 287.35200 | |
| Density | 1.31g/cm3 | Boiling Point | 483.2ºC at 760 mmHg | |
| Molecular Formula | C16H14FNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246ºC | |
| Name | N-(7-fluoro-1-methylsulfanyl-9H-fluoren-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 483.2ºC at 760 mmHg |
| Molecular Formula | C16H14FNOS |
| Molecular Weight | 287.35200 |
| Flash Point | 246ºC |
| Exact Mass | 287.07800 |
| PSA | 57.89000 |
| LogP | 4.72670 |
| Index of Refraction | 1.65 |
| InChIKey | PWYCWXGZQHWJSW-UHFFFAOYSA-N |
| SMILES | CSc1c(NC(C)=O)ccc2c1Cc1cc(F)ccc1-2 |
|
~%
N-(7-fluoro-1-m... CAS#:97235-36-4 |
| Literature: Elfarra; Hanna Journal of Medicinal Chemistry, 1985 , vol. 28, # 10 p. 1453 - 1460 |
|
~%
N-(7-fluoro-1-m... CAS#:97235-36-4 |
| Literature: Elfarra; Hanna Journal of Medicinal Chemistry, 1985 , vol. 28, # 10 p. 1453 - 1460 |
![[acetyl-(7-fluoro-9H-fluoren-2-yl)amino] acetate structure](https://image.chemsrc.com/caspic/317/6344-58-7.png)
![Acetamide,N-[7-fluoro-3-(methylthio)-9H-fluoren-2-yl]- structure](https://image.chemsrc.com/caspic/071/16233-02-6.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(methylthio)-7-fluoro-2-acetamidofluorene |
| Acetamide,N-(7-fluoro-1-(methylthio)-9h-fluoren-2-yl) |