3-[2-(3-carbonochloridoylphenyl)ethenyl]benzoyl chloride structure
|
Common Name | 3-[2-(3-carbonochloridoylphenyl)ethenyl]benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 97203-72-0 | Molecular Weight | 305.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[2-(3-carbonochloridoylphenyl)ethenyl]benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H10Cl2O2 |
|---|---|
| Molecular Weight | 305.15500 |
| Exact Mass | 304.00600 |
| PSA | 34.14000 |
| LogP | 4.61500 |
| InChIKey | LKZKPMOFIICTQO-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cccc(C=Cc2cccc(C(=O)Cl)c2)c1 |
|
~72%
3-[2-(3-carbono... CAS#:97203-72-0 |
| Literature: Shinkai, Seiji; Miyazaki, Kiminori; Nakashima, Mikio; Manabe, Osamu Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 3 p. 1059 - 1060 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Stilbene-3,3'-dicarbonyl Dichloride |
| Benzoyl chloride,3,3'-(1,2-ethenediyl)bis |
| 3,3'-bis(chloroformyl)stilbene |