2,5-dihydroxybenzoic acid, compound with N4-(7-chloro-4-quinolyl)-N1,N1-diethylpentane-1,4-diamine (2:1) structure
|
Common Name | 2,5-dihydroxybenzoic acid, compound with N4-(7-chloro-4-quinolyl)-N1,N1-diethylpentane-1,4-diamine (2:1) | ||
|---|---|---|---|---|
| CAS Number | 97158-47-9 | Molecular Weight | 628.11200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H38ClN3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine,2,5-dihydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H38ClN3O8 |
|---|---|
| Molecular Weight | 628.11200 |
| Exact Mass | 627.23500 |
| PSA | 183.68000 |
| LogP | 6.47560 |
| InChIKey | PWNQHEPDSGENCN-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12.O=C(O)c1cc(O)ccc1O.O=C(O)c1cc(O)ccc1O |
| EINECS 306-377-0 |
| 2,5-Dihydroxybenzoic acid,compound with N4-(7-chloro-4-quinolyl)-N1,N1-diethylpentane-1,4-diamine (2:1) |