KKI 5
Modify Date: 2025-08-26 18:55:53
KKI 5 structure
|
Common Name | KKI 5 | ||
|---|---|---|---|---|
| CAS Number | 97145-43-2 | Molecular Weight | 773.87900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H55N11O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of KKI 5Kallikrein Inhibitor is a synthetic peptide. The synthetic kallikrein inhibitor can attenuate breast cancer cell invasion. |
| Name | kallikrein inhibitor |
|---|
| Description | Kallikrein Inhibitor is a synthetic peptide. The synthetic kallikrein inhibitor can attenuate breast cancer cell invasion. |
|---|---|
| Related Catalog | |
| In Vitro | The Kallikrein Inhibitor Peptide corresponds to aa386-391 of bovine kininogen-1 that encompasses the aa388-389 kallikrein proteolytic site. The synthetic kallikrein inhibitor can attenuate breast cancer cell invasion, therefore it is investigated for its role in invasion and metastasis of cancer cells. |
| Molecular Formula | C35H55N11O9 |
|---|---|
| Molecular Weight | 773.87900 |
| Exact Mass | 773.41800 |
| PSA | 334.12000 |
| LogP | 0.81030 |
| InChIKey | OOZYLOMMGMLDHT-BIVGDOEESA-N |
| SMILES | CC(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(C(=O)NC(CCC(N)=O)C(N)=O)C(C)C |
| Storage condition | 2-8℃ |