2-[(4-oxo-3,1-benzoxazin-2-yl)methyl]isoindole-1,3-dione structure
|
Common Name | 2-[(4-oxo-3,1-benzoxazin-2-yl)methyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 97118-79-1 | Molecular Weight | 306.27200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(4-oxo-3,1-benzoxazin-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H10N2O4 |
|---|---|
| Molecular Weight | 306.27200 |
| Exact Mass | 306.06400 |
| PSA | 80.48000 |
| LogP | 1.92210 |
| InChIKey | FEXWXVYNEWKTKL-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1nc2ccccc2c(=O)o1 |
|
~58%
2-[(4-oxo-3,1-b... CAS#:97118-79-1 |
| Literature: Kulkarni; Bishnoi Journal of the Indian Chemical Society, 1990 , vol. 67, # 10 p. 852 - 854 |
| 2-((4-Oxo-4H-3,1-benzoxazin-2-yl)methyl)-1H-isoindole-1,3(2H)-dione |