3-(2-aminoethyl)-4,7-dimethyl-1H-indole-5,6-diol
Modify Date: 2025-08-22 18:23:18
3-(2-aminoethyl)-4,7-dimethyl-1H-indole-5,6-diol structure
|
Common Name | 3-(2-aminoethyl)-4,7-dimethyl-1H-indole-5,6-diol | ||
|---|---|---|---|---|
| CAS Number | 97073-72-8 | Molecular Weight | 220.26800 | |
| Density | 1.312g/cm3 | Boiling Point | 459.1ºC at 760mmHg | |
| Molecular Formula | C12H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.4ºC | |
| Name | 3-(2-aminoethyl)-4,7-dimethyl-1H-indole-5,6-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.312g/cm3 |
|---|---|
| Boiling Point | 459.1ºC at 760mmHg |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.26800 |
| Flash Point | 231.4ºC |
| Exact Mass | 220.12100 |
| PSA | 82.27000 |
| LogP | 2.39740 |
| Index of Refraction | 1.702 |
| InChIKey | ZPYZCLCQXCZFIP-UHFFFAOYSA-N |
| SMILES | Cc1c(O)c(O)c(C)c2c(CCN)c[nH]c12 |
|
~%
3-(2-aminoethyl... CAS#:97073-72-8 |
| Literature: Sinhababu, Achintya K.; Ghosh, Anil K.; Borchardt, Ronald T. Journal of Medicinal Chemistry, 1985 , vol. 28, # 9 p. 1273 - 1279 |
|
~%
3-(2-aminoethyl... CAS#:97073-72-8 |
| Literature: Sinhababu, Achintya K.; Ghosh, Anil K.; Borchardt, Ronald T. Journal of Medicinal Chemistry, 1985 , vol. 28, # 9 p. 1273 - 1279 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,7-Dimethyl-5,6-dihydroxytryptamine |
| 5,6-dihydroxy-4,7-dimethyltryptamine creatinine sulfate |
| 4,7-Dime-5,6-dht |