1,4-dimethyl-3-(2-nitroethenyl)-7-propan-2-ylazulene structure
|
Common Name | 1,4-dimethyl-3-(2-nitroethenyl)-7-propan-2-ylazulene | ||
|---|---|---|---|---|
| CAS Number | 96995-26-5 | Molecular Weight | 269.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-dimethyl-3-(2-nitroethenyl)-7-propan-2-ylazulene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19NO2 |
|---|---|
| Molecular Weight | 269.33800 |
| Exact Mass | 269.14200 |
| PSA | 45.82000 |
| LogP | 5.30220 |
| InChIKey | KWVHAVHMCGMCGT-UHFFFAOYSA-N |
| SMILES | Cc1cc(C=C[N+](=O)[O-])c2c(C)ccc(C(C)C)cc1-2 |
|
~1%
1,4-dimethyl-3-... CAS#:96995-26-5 |
| Literature: Kurokawa; Anderson Jr. Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 1 p. 367 - 373 |
|
~10%
1,4-dimethyl-3-... CAS#:96995-26-5 |
| Literature: Kurokawa; Anderson Jr. Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 1 p. 367 - 373 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(2-Nitroethenyl)guaiazulene |
| Azulene,1,4-dimethyl-7-(1-methylethyl)-3-(2-nitroethenyl)-,(E) |
| 3-(2-nitroethenyl)guaiazulene |