1-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one structure
|
Common Name | 1-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 96935-32-9 | Molecular Weight | 390.34100 | |
| Density | 1.632g/cm3 | Boiling Point | 725.4ºC at 760 mmHg | |
| Molecular Formula | C19H18O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.3ºC | |
| Name | 1-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.632g/cm3 |
|---|---|
| Boiling Point | 725.4ºC at 760 mmHg |
| Molecular Formula | C19H18O9 |
| Molecular Weight | 390.34100 |
| Flash Point | 264.3ºC |
| Exact Mass | 390.09500 |
| PSA | 149.82000 |
| Index of Refraction | 1.706 |
| InChIKey | XPJKXAFFVPUMHO-LQDZTQBFSA-N |
| SMILES | O=c1c2cc(OC3OC(CO)C(O)C(O)C3O)ccc2oc2cccc(O)c12 |
|
~%
1-hydroxy-7-[(2... CAS#:96935-32-9 |
| Literature: Robertson; Waters Journal of the Chemical Society, 1929 , p. 2239,2241 |
|
~%
1-hydroxy-7-[(2... CAS#:96935-32-9 |
| Literature: Robertson; Waters Journal of the Chemical Society, 1929 , p. 2239,2241 |
|
~%
1-hydroxy-7-[(2... CAS#:96935-32-9 |
| Literature: Robertson; Waters Journal of the Chemical Society, 1929 , p. 2239,2241 |
| Wubangziside B |
| Euxanthone-7-O-glucopyranoside |