8-bromo-7-[2-(4-ethylphenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione structure
|
Common Name | 8-bromo-7-[2-(4-ethylphenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 96885-28-8 | Molecular Weight | 405.24600 | |
| Density | 1.56g/cm3 | Boiling Point | 604.9ºC at 760mmHg | |
| Molecular Formula | C17H17BrN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.6ºC | |
| Name | 8-bromo-7-[2-(4-ethylphenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 604.9ºC at 760mmHg |
| Molecular Formula | C17H17BrN4O3 |
| Molecular Weight | 405.24600 |
| Flash Point | 319.6ºC |
| Exact Mass | 404.04800 |
| PSA | 78.89000 |
| LogP | 1.64150 |
| Index of Refraction | 1.676 |
| InChIKey | AWIGUZKVXQXREY-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(=O)Cn2c(Br)nc3c2c(=O)n(C)c(=O)n3C)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,7-Dihydro-8-bromo-1,3-dimethyl-7-(2-(4-ethylphenyl)-2-oxoethyl)-1H-purine-2,6-dione |
| 8-BROMO-7-[2-(4-ETHYLPHENYL)-2-OXO-ETHYL]-1,3-DIMETHYL-PURINE-2,6-DION E |
| p-Ethylbenzoylmethyl-8-bromotheophyllin |
| 1H-Purine-2,6-dione,3,7-dihydro-8-bromo-1,3-dimethyl-7-(2-(4-ethylphenyl)-2-oxoethyl) |
| p-Ethylbenzoylmethyl-8-bromotheophylline |