N-(5-oxo-4,4-diphenylheptan-2-yl)formamide structure
|
Common Name | N-(5-oxo-4,4-diphenylheptan-2-yl)formamide | ||
|---|---|---|---|---|
| CAS Number | 96740-78-2 | Molecular Weight | 309.40200 | |
| Density | 1.071g/cm3 | Boiling Point | 511.3ºC at 760mmHg | |
| Molecular Formula | C20H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.7ºC | |
| Name | N-(5-oxo-4,4-diphenylheptan-2-yl)formamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.071g/cm3 |
|---|---|
| Boiling Point | 511.3ºC at 760mmHg |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.40200 |
| Flash Point | 174.7ºC |
| Exact Mass | 309.17300 |
| PSA | 49.66000 |
| LogP | 4.31670 |
| Index of Refraction | 1.545 |
| InChIKey | SOADEMGSJIXQJO-UHFFFAOYSA-N |
| SMILES | CCC(=O)C(CC(C)NC=O)(c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (+/-)-6-formamido-4,4-diphenyl-3-heptanone |
| N-(5-OXO-4,4-DIPHENYL-HEPTAN-2-YL)FORMAMIDE |
| 2-Formamido-4,4-diphenyl-5-heptanone |
| FADPH |