methyl 2-amino-3-(3-hydroxyphenyl)-2-methylpropanoate,hydrate,hydrochloride structure
|
Common Name | methyl 2-amino-3-(3-hydroxyphenyl)-2-methylpropanoate,hydrate,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 96687-21-7 | Molecular Weight | 263.71800 | |
| Density | N/A | Boiling Point | 368.6ºC at 760mmHg | |
| Molecular Formula | C11H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.7ºC | |
| Name | methyl 2-amino-3-(3-hydroxyphenyl)-2-methylpropanoate,hydrate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 368.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H18ClNO4 |
| Molecular Weight | 263.71800 |
| Flash Point | 176.7ºC |
| Exact Mass | 263.09200 |
| PSA | 81.78000 |
| LogP | 2.26310 |
| InChIKey | GPQGEKMCOYNFKU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)(N)Cc1cccc(O)c1.Cl.O |
| WGK Germany | 3 |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| DL-2-Methyl-3-[3-hydroxy-phenyl]alanine methyl ester |
| hydrate methyl 2-amino-3-(3-hydroxyphenyl)-2-methylpropanoate hydrochloride |