trimethyl-(3,3,4-trimethylcyclohexen-1-yl)oxysilane structure
|
Common Name | trimethyl-(3,3,4-trimethylcyclohexen-1-yl)oxysilane | ||
|---|---|---|---|---|
| CAS Number | 96641-38-2 | Molecular Weight | 212.40400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H24OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(3,3,4-trimethylcyclohexen-1-yl)oxysilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H24OSi |
|---|---|
| Molecular Weight | 212.40400 |
| Exact Mass | 212.16000 |
| PSA | 9.23000 |
| LogP | 4.17790 |
| InChIKey | VUZYEWGTQMKGAM-UHFFFAOYSA-N |
| SMILES | CC1CCC(O[Si](C)(C)C)=CC1(C)C |
|
~%
trimethyl-(3,3,... CAS#:96641-38-2 |
| Literature: Takazawa, Osamu; Kogami, Kunio; Hayashi, Kazuo Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 1 p. 389 - 390 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Silane,trimethyl[(3,3,4-trimethyl-1-cyclohexen-1-yl)oxy] |
| 3,3,4-Trimethyl-1-trimethylsiloxy-1-cyclohexene |