Thermid IP-600, IP-630
Modify Date: 2025-09-18 22:55:11
Thermid IP-600, IP-630 structure
|
Common Name | Thermid IP-600, IP-630 | ||
|---|---|---|---|---|
| CAS Number | 96591-24-1 | Molecular Weight | 731.70500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H29N3O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[3-(3-aminophenoxy)phenoxy]aniline,5-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-benzofuran-1,3-dione,3-ethynylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C43H29N3O9 |
|---|---|
| Molecular Weight | 731.70500 |
| Exact Mass | 731.19000 |
| PSA | 200.33000 |
| LogP | 8.96810 |
| InChIKey | VICGFMKJKKROAV-UHFFFAOYSA-N |
| SMILES | C#Cc1cccc(N)c1.Nc1cccc(Oc2cccc(Oc3cccc(N)c3)c2)c1.O=C(c1ccc2c(c1)C(=O)OC2=O)c1ccc2c(c1)C(=O)OC2=O |
| 1,3-Isobenzofurandione,5,5'-carbonylbis-,reaction products with 3-ethynylbenzenamine and 3,3'-(1,3-phenylenebis(oxy))bis(benzenamine) |