3beta-Hydroxylanosta-8,24-diene-21-al
Modify Date: 2025-09-18 18:36:17
3beta-Hydroxylanosta-8,24-diene-21-al structure
|
Common Name | 3beta-Hydroxylanosta-8,24-diene-21-al | ||
|---|---|---|---|---|
| CAS Number | 96574-03-7 | Molecular Weight | 440.70 | |
| Density | N/A | Boiling Point | 529.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3beta-Hydroxylanosta-8,24-diene-21-al3β-Hydroxylanosta-8,24-dien-21-al is a lanostane-type triterpene. 3β-Hydroxylanosta-8,24-dien-21-al can inhibit the tumor promotion, reducing the percentage of mice bearing papillomas[1]. |
| Name | (2R)-2-[(3S,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enal |
|---|
| Description | 3β-Hydroxylanosta-8,24-dien-21-al is a lanostane-type triterpene. 3β-Hydroxylanosta-8,24-dien-21-al can inhibit the tumor promotion, reducing the percentage of mice bearing papillomas[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 529.2±50.0 °C at 760 mmHg |
|---|---|
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.70 |
| Exact Mass | 440.36500 |
| PSA | 37.30000 |
| LogP | 7.65810 |
| InChIKey | BDXXTCGLJBYHHM-MSEDFXBCSA-N |
| SMILES | CC(C)=CCCC(C=O)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(O)C(C)(C)C1CC3 |