(1S)-2-oxobornane-10-sulphonic acid, compound with (S)-1'-benzyl-3-phenyl[3,4'-bipiperidine]-2,6-dione (1:1) structure
|
Common Name | (1S)-2-oxobornane-10-sulphonic acid, compound with (S)-1'-benzyl-3-phenyl[3,4'-bipiperidine]-2,6-dione (1:1) | ||
|---|---|---|---|---|
| CAS Number | 96507-71-0 | Molecular Weight | 594.76100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H42N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3S)-3-(1-benzylpiperidin-4-yl)-3-phenylpiperidine-2,6-dione,[(1R,4S)-7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C33H42N2O6S |
|---|---|
| Molecular Weight | 594.76100 |
| Exact Mass | 594.27600 |
| PSA | 132.72000 |
| LogP | 5.83740 |
| InChIKey | BRVFOSDWKGENNW-GLKYBNCWSA-N |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.O=C1CCC(c2ccccc2)(C2CCN(Cc3ccccc3)CC2)C(=O)N1 |
| einecs 306-149-0 |