1,3-Propanediol, 2-methyl-2-((9-phenanthrenylmethyl)amino)-, hydrochlo ride structure
|
Common Name | 1,3-Propanediol, 2-methyl-2-((9-phenanthrenylmethyl)amino)-, hydrochlo ride | ||
|---|---|---|---|---|
| CAS Number | 96404-20-5 | Molecular Weight | 331.83600 | |
| Density | N/A | Boiling Point | 543.9ºC at 760mmHg | |
| Molecular Formula | C19H22ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.8ºC | |
| Name | 2-methyl-2-(phenanthren-9-ylmethylamino)propane-1,3-diol,hydrochloride |
|---|
| Boiling Point | 543.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.83600 |
| Flash Point | 187.8ºC |
| Exact Mass | 331.13400 |
| PSA | 52.49000 |
| LogP | 4.01880 |
| InChIKey | WFXFFSXUGOGZTA-UHFFFAOYSA-N |
| SMILES | CC(CO)(CO)NCc1cc2ccccc2c2ccccc12.Cl |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |