N,N''-BIS-(2-NITRO-PHENYL)-MALONAMIDE
Modify Date: 2025-08-25 07:18:07
N,N''-BIS-(2-NITRO-PHENYL)-MALONAMIDE structure
|
Common Name | N,N''-BIS-(2-NITRO-PHENYL)-MALONAMIDE | ||
|---|---|---|---|---|
| CAS Number | 96331-35-0 | Molecular Weight | 344.27900 | |
| Density | 1.539g/cm3 | Boiling Point | 680.5ºC at 760mmHg | |
| Molecular Formula | C15H12N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365.3ºC | |
| Name | N,N'-bis(2-nitrophenyl)propanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.539g/cm3 |
|---|---|
| Boiling Point | 680.5ºC at 760mmHg |
| Molecular Formula | C15H12N4O6 |
| Molecular Weight | 344.27900 |
| Flash Point | 365.3ºC |
| Exact Mass | 344.07600 |
| PSA | 156.82000 |
| LogP | 4.81570 |
| Index of Refraction | 1.71 |
| InChIKey | AESMHZVRTXLXHT-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)Nc1ccccc1[N+](=O)[O-])Nc1ccccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
N,N''-BIS-(2-NI... CAS#:96331-35-0 |
| Literature: Naik; Talati Journal of the Indian Chemical Society, 1931 , vol. 8, p. 206 Chem. Zentralbl., 1931 , vol. 102, # II p. 2594 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HMS2852A17 |
| N,N'-Bis-(2-nitro-phenyl)-malonamide |
| Malonsaeure-bis-<2-nitro-anilid> |