1-(1,3-benzodioxol-5-yl)-3-piperidin-1-ylpropan-1-one,hydrochloride structure
|
Common Name | 1-(1,3-benzodioxol-5-yl)-3-piperidin-1-ylpropan-1-one,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 962-21-0 | Molecular Weight | 297.77700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1,3-benzodioxol-5-yl)-3-piperidin-1-ylpropan-1-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H20ClNO3 |
|---|---|
| Molecular Weight | 297.77700 |
| Exact Mass | 297.11300 |
| PSA | 38.77000 |
| LogP | 3.21390 |
| InChIKey | RVTQHJIXRVYDLE-UHFFFAOYSA-N |
| SMILES | Cl.O=C(CCN1CCCCC1)c1ccc2c(c1)OCO2 |
|
~%
1-(1,3-benzodio... CAS#:962-21-0 |
| Literature: Denton et al. Journal of the American Chemical Society, 1949 , vol. 71, p. 2050,2052 Journal of the American Chemical Society, 1950 , vol. 72, p. 3795 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Propanone,1-(1,3-benzodioxol-5-yl)-3-(1-piperidinyl)-,hydrochloride |
| 1-benzo[1,3]dioxol-5-yl-3-piperidino-propan-1-one,hydrochloride |
| 1-Benzo[1,3]dioxol-5-yl-3-piperidino-propan-1-on,Hydrochlorid |