1-[chloro(phenyl)phosphoryl]oxy-4-nitrobenzene structure
|
Common Name | 1-[chloro(phenyl)phosphoryl]oxy-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 96155-91-8 | Molecular Weight | 297.63100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9ClNO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[chloro(phenyl)phosphoryl]oxy-4-nitrobenzene |
|---|
| Molecular Formula | C12H9ClNO4P |
|---|---|
| Molecular Weight | 297.63100 |
| Exact Mass | 296.99600 |
| PSA | 81.93000 |
| LogP | 4.25420 |
| InChIKey | CEOVSDWPHJPNQM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OP(=O)(Cl)c2ccccc2)cc1 |
|
~%
1-[chloro(pheny... CAS#:96155-91-8 |
| Literature: Bourne, Nicholas; Williams, Andrew Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1985 , p. 265 - 268 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |