1,2,3,4-tetrachloro-5-phenylcyclohexa-1,3-diene structure
|
Common Name | 1,2,3,4-tetrachloro-5-phenylcyclohexa-1,3-diene | ||
|---|---|---|---|---|
| CAS Number | 96155-56-5 | Molecular Weight | 294.00400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8Cl4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3,4-tetrachloro-5-phenylcyclohexa-1,3-diene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8Cl4 |
|---|---|
| Molecular Weight | 294.00400 |
| Exact Mass | 291.93800 |
| LogP | 5.55230 |
| InChIKey | AEZOFUUXLJXTGF-UHFFFAOYSA-N |
| SMILES | ClC1=C(Cl)C(Cl)=C(Cl)C(c2ccccc2)C1 |
|
~%
1,2,3,4-tetrach... CAS#:96155-56-5 |
| Literature: Scherer,K.V.; Meyers,T.J. Journal of the American Chemical Society, 1968 , vol. 90, p. 6253 - 6254 |
|
~%
1,2,3,4-tetrach... CAS#:96155-56-5 |
| Literature: Baro, J.; Dudek, D.; Luther, K.; Troe, J. Zeitschrift fuer Physikalische Chemie (Muenchen, Germany), 1984 , vol. 140, p. 167 - 180 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzene,(2,3,4,5-tetrachloro-2,4-cyclohexadien-1-yl) |
| 1,2,3,4-Tetrachlor-5-phenyl-cyclohexadien-(1,3) |
| 2,3,4,5-tetrachloro-1,6-dihydro-1,1'-biphenyl |
| 1,2,3,4-Tetrachlor-5-phenyl-cyclohexa-1,3-dien |
| 1,2,3,4-tetrachloro-5-phenyl-cyclohexa-1,3-diene |