Bisfentidine
Modify Date: 2025-09-05 15:53:43
Bisfentidine structure
|
Common Name | Bisfentidine | ||
|---|---|---|---|---|
| CAS Number | 96153-56-9 | Molecular Weight | 242.32000 | |
| Density | 1.11g/cm3 | Boiling Point | 468ºC at 760mmHg | |
| Molecular Formula | C14H18N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.8ºC | |
| Name | N-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-N'-propan-2-ylmethanimidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 468ºC at 760mmHg |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.32000 |
| Flash Point | 236.8ºC |
| Exact Mass | 242.15300 |
| PSA | 53.07000 |
| LogP | 3.43380 |
| Index of Refraction | 1.593 |
| InChIKey | FXJAOWANXXJWGJ-UHFFFAOYSA-N |
| SMILES | Cc1ncc(-c2ccc(NC=NC(C)C)cc2)[nH]1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| DA-5047 |
| Bisfentidine |
| Bisfentidine [INN] |