N,N-diethyl-3-(hydrazinecarbonyl)benzenesulfonamide structure
|
Common Name | N,N-diethyl-3-(hydrazinecarbonyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 96134-80-4 | Molecular Weight | 271.33600 | |
| Density | 1.259g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H17N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-diethyl-3-(hydrazinecarbonyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259g/cm3 |
|---|---|
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.33600 |
| Exact Mass | 271.09900 |
| PSA | 104.37000 |
| LogP | 2.67650 |
| Index of Refraction | 1.562 |
| InChIKey | JVJRCNQOLBMRQX-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NN)c1 |
| HS Code | 2935009090 |
|---|
|
~%
N,N-diethyl-3-(... CAS#:96134-80-4 |
| Literature: Peet, Norton P.; Sunder, Shyam Journal of Heterocyclic Chemistry, 1984 , vol. 21, p. 1807 - 1816 |
|
~%
N,N-diethyl-3-(... CAS#:96134-80-4 |
| Literature: Peet, Norton P.; Sunder, Shyam Journal of Heterocyclic Chemistry, 1984 , vol. 21, p. 1807 - 1816 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 3-<(Diethylamino)sulfonyl>benzoic Acid Hydrazide |
| n,n-diethyl-3-hydrazinocarbonyl-benzenesulfonamide |
| diethyl[(3-phenyl)sulfonyl]amine |