1H-Indole,3-[(phenylsulfonyl)methyl]- structure
|
Common Name | 1H-Indole,3-[(phenylsulfonyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 961-31-9 | Molecular Weight | 271.33400 | |
| Density | 1.327g/cm3 | Boiling Point | 545ºC at 760mmHg | |
| Molecular Formula | C15H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.4ºC | |
| Name | 3-(benzenesulfonylmethyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 545ºC at 760mmHg |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.33400 |
| Flash Point | 283.4ºC |
| Exact Mass | 271.06700 |
| PSA | 58.31000 |
| LogP | 4.22260 |
| Index of Refraction | 1.67 |
| InChIKey | FPECZKOKWBCKDL-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cc1c[nH]c2ccccc12)c1ccccc1 |
|
~%
1H-Indole,3-[(p... CAS#:961-31-9 |
| Literature: Licari; Dougherty Journal of the American Chemical Society, 1954 , vol. 76, p. 4039 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Benzolsulfonylmethyl-indol |
| 3-benzenesulfonylmethyl-indole |
| 3-Benzenesulfonylmethyl-1H-indole |