3-methyl-1,1-bis(2,4,6-trimethylphenyl)but-1-en-2-ol structure
|
Common Name | 3-methyl-1,1-bis(2,4,6-trimethylphenyl)but-1-en-2-ol | ||
|---|---|---|---|---|
| CAS Number | 96040-91-4 | Molecular Weight | 322.48400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H30O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-1,1-bis(2,4,6-trimethylphenyl)but-1-en-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H30O |
|---|---|
| Molecular Weight | 322.48400 |
| Exact Mass | 322.23000 |
| PSA | 20.23000 |
| LogP | 6.51040 |
| InChIKey | NSGULIWSTWXQSS-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=C(O)C(C)C)c2c(C)cc(C)cc2C)c(C)c1 |
|
~42%
3-methyl-1,1-bi... CAS#:96040-91-4 |
| Literature: Nugiel,D.A.; Rappoport,Z. Journal of the American Chemical Society, 1985 , vol. 107, p. 3669 |
|
~%
3-methyl-1,1-bi... CAS#:96040-91-4 |
| Literature: Nugiel,D.A.; Rappoport,Z. Journal of the American Chemical Society, 1985 , vol. 107, p. 3669 |
| 1,1-Dimesityl-3-methyl-1-buten-2-ol |
| 1-Buten-2-ol,3-methyl-1,1-bis(2,4,6-trimethylphenyl) |